Misplaced Pages

Emrusolmin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactivelyContent deleted Content addedVisualWikitext
Revision as of 13:30, 24 December 2024 editInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,114 edits new page  Latest revision as of 10:34, 9 January 2025 edit undoPreimage (talk | contribs)Extended confirmed users1,337 edits removed Category:Bromobenzenes; added Category:Bromobenzene derivatives using HotCat 
(6 intermediate revisions by 4 users not shown)
Line 1: Line 1:
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug {{Infobox drug
| drug_name = | drug_name =
Line 4: Line 5:
| type = <!-- empty --> | type = <!-- empty -->
| image = Emrusolmin.svg | image = Emrusolmin.svg
| alt = 200px | width = 200px
| alt =
| caption = | caption =
| image2 =
| width2 =
| alt2 =
| caption2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| captionLR =

<!-- Clinical data --> <!-- Clinical data -->
| pronounce = | pronounce =
Line 11: Line 25:
| Drugs.com = | Drugs.com =
| MedlinePlus = | MedlinePlus =
| licence_CA =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment = | pregnancy_AU_comment =
| pregnancy_category= | pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration = | routes_of_administration =
| class =

<!-- Legal status -->
| ATCvet = | ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised --> | ATC_prefix = <!-- 'none' if uncategorised -->
Line 38: Line 61:
| legal_UN_comment = | legal_UN_comment =
| legal_status = Investigational | legal_status = Investigational

<!-- Pharmacokinetic data --> <!-- Pharmacokinetic data -->
| bioavailability = | bioavailability =
Line 47: Line 71:
| duration_of_action= | duration_of_action=
| excretion = | excretion =

<!-- Identifiers --> <!-- Identifiers -->
| synonyms = Anle138b, TEV-56286 | CAS_number = 882697-00-9
| CAS_supplemental =
| CAS_number = 882697-00-9
| PubChem = 44608289 | PubChem = 44608289
| UNII = E7WRA77JET | IUPHAR_ligand =
| DrugBank = DB13927 | DrugBank = DB13927
| ChemSpiderID = 58825097
| UNII = E7WRA77JET
| KEGG = D80685
| ChEBI = 232606
| ChEMBL = 4748063
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = Anle138b, TEV-56286

<!-- Chemical and physical data --> <!-- Chemical and physical data -->
| IUPAC_name = 5-(1,3-Benzodioxol-5-yl)-3-(3-bromophenyl)-1''H''-pyrazole | IUPAC_name = <nowiki>5-(1,3-benzodioxol-5-yl)-3-(3-bromophenyl)-1H-pyrazole</nowiki>
| C = 16 | H = 11 | Br = 1 | N = 2 | O = 2 | C=16 | H=11 | Br=1 | N=2 | O=2
| molecular_weight =
| smiles = C1OC2=C(O1)C=C(C=C2)C3=CC(=NN3)C4=CC(=CC=C4)Br | SMILES = C1OC2=C(O1)C=C(C=C2)C3=CC(=NN3)C4=CC(=CC=C4)Br
| Jmol =
| StdInChI = InChI=1S/C16H11BrN2O2/c17-12-3-1-2-10(6-12)13-8-14(19-18-13)11-4-5-15-16(7-11)21-9-20-15/h1-8H,9H2,(H,18,19)
| StdInChI_comment =
| StdInChIKey = RCQIIBJSUWYYFU-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}} }}


'''Emrusolmin''' (development code '''Anle138b''') is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of ] which is implicated in the development of ].<ref>{{cite journal | doi = 10.1007/s00401-013-1114-9 }}</ref><ref>{{cite journal | doi = 10.1016/j.ymeth.2023.04.002 }}</ref><ref>{{cite journal | doi = 10.1038/s41467-022-32797-w }}</ref> Other proteins it inhibits the aggregation of include ]<ref>{{cite journal | doi = 10.1007/s00401-015-1483-3 }}</ref> which is associated with ] (AD) and ], and ]<ref>{{cite journal | doi = 10.15252/emmm.201707825 }}</ref> which is associated with AD. '''Emrusolmin''' (development code '''Anle138b''') is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of ] which is implicated in the development of ].<ref>{{cite journal | doi = 10.1007/s00401-013-1114-9 | title = Anle138b: A novel oligomer modulator for disease-modifying therapy of neurodegenerative diseases such as prion and Parkinson's disease | date = 2013 | vauthors = Wagner J, Ryazanov S, Leonov A, Levin J, Shi S, Schmidt F, Prix C, Pan-Montojo F, Bertsch U, Mitteregger-Kretzschmar G, Geissen M, Eiden M, Leidel F, Hirschberger T, Deeg AA, Krauth JJ, Zinth W, Tavan P, Pilger J, Zweckstetter M, Frank T, Bähr M, Weishaupt JH, Uhr M, Urlaub H, Teichmann U, Samwer M, Bötzel K, Groschup M, Kretzschmar H | journal = Acta Neuropathologica | volume = 125 | issue = 6 | pages = 795–813 | pmid = 23604588 | pmc = 3661926 }}</ref><ref>{{cite journal | doi = 10.1016/j.ymeth.2023.04.002 | title = Anle138b interaction in α-synuclein aggregates by dynamic nuclear polarization NMR | date = 2023 | vauthors = Dervişoğlu R, Antonschmidt L, Nimerovsky E, Sant V, Kim M, Ryazanov S, Leonov A, Fuentes-Monteverde JC, Wegstroth M, Giller K, Mathies G, Giese A, Becker S, Griesinger C, Andreas LB | journal = Methods | volume = 214 | pages = 18–27 | pmid = 37037308 | doi-access = free }}</ref><ref>{{cite journal | doi = 10.1038/s41467-022-32797-w | title = The clinical drug candidate anle138b binds in a cavity of lipidic α-synuclein fibrils | date = 2022 | vauthors = Antonschmidt L, Matthes D, DervişOğLu R, Frieg B, Dienemann C, Leonov A, Nimerovsky E, Sant V, Ryazanov S, Giese A, Schröder GF, Becker S, De Groot BL, Griesinger C, Andreas LB | journal = Nature Communications | volume = 13 | issue = 1 | page = 5385 | pmid = 36104315 | pmc = 9474542 | bibcode = 2022NatCo..13.5385A }}</ref> Other proteins it inhibits the aggregation of include ]<ref>{{cite journal | doi = 10.1007/s00401-015-1483-3 | title = Reducing tau aggregates with anle138b delays disease progression in a mouse model of tauopathies | date = 2015 | vauthors = Wagner J, Krauss S, Shi S, Ryazanov S, Steffen J, Miklitz C, Leonov A, Kleinknecht A, Göricke B, Weishaupt JH, Weckbecker D, Reiner AM, Zinth W, Levin J, Ehninger D, Remy S, Kretzschmar HA, Griesinger C, Giese A, Fuhrmann M | journal = Acta Neuropathologica | volume = 130 | issue = 5 | pages = 619–631 | pmid = 26439832 | pmc = 4612332 }}</ref> which is associated with ] (AD) and ], and ]<ref>{{cite journal | doi = 10.15252/emmm.201707825 | title = The diphenylpyrazole compound anle138b blocks Aβ channels and rescues disease phenotypes in a mouse model for amyloid pathology | date = 2018 | vauthors = Martinez Hernandez A, Urbanke H, Gillman AL, Lee J, Ryazanov S, Agbemenyah HY, Benito E, Jain G, Kaurani L, Grigorian G, Leonov A, Rezaei-Ghaleh N, Wilken P, Arce FT, Wagner J, Fuhrman M, Caruana M, Camilleri A, Vassallo N, Zweckstetter M, Benz R, Giese A, Schneider A, Korte M, Lal R, Griesinger C, Eichele G, Fischer A | journal = EMBO Molecular Medicine | volume = 10 | issue = 1 | pages = 32–47 | pmid = 29208638 | pmc = 5760857 }}</ref> which is associated with AD.


It is currently in clinical trials for Parkinson's disease and ].<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800046788 | title = Emrusolmin - Modag | publisher = AdisInsight }}</ref> It is currently in clinical trials for Parkinson's disease and ].<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800046788 | title = Emrusolmin - Modag | work = AdisInsight | publisher = Springer Nature Switzerland AG }}</ref>


==References== ==References==
Line 70: Line 119:
] ]
] ]
] ]
] ]

Latest revision as of 10:34, 9 January 2025

Pharmaceutical compound
Emrusolmin
Clinical data
Other namesAnle138b, TEV-56286
Legal status
Legal status
  • Investigational
Identifiers
IUPAC name
  • 5-(1,3-benzodioxol-5-yl)-3-(3-bromophenyl)-1H-pyrazole
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
Chemical and physical data
FormulaC16H11BrN2O2
Molar mass343.180 g·mol
3D model (JSmol)
SMILES
  • C1OC2=C(O1)C=C(C=C2)C3=CC(=NN3)C4=CC(=CC=C4)Br
InChI
  • InChI=InChI=1S/C16H11BrN2O2/c17-12-3-1-2-10(6-12)13-8-14(19-18-13)11-4-5-15-16(7-11)21-9-20-15/h1-8H,9H2,(H,18,19)
  • Key:RCQIIBJSUWYYFU-UHFFFAOYSA-N

Emrusolmin (development code Anle138b) is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of α-synuclein which is implicated in the development of Parkinson's disease. Other proteins it inhibits the aggregation of include tau which is associated with Alzheimer's disease (AD) and tauopathy, and amyloid beta which is associated with AD.

It is currently in clinical trials for Parkinson's disease and multiple system atrophy.

References

  1. Wagner J, Ryazanov S, Leonov A, Levin J, Shi S, Schmidt F, et al. (2013). "Anle138b: A novel oligomer modulator for disease-modifying therapy of neurodegenerative diseases such as prion and Parkinson's disease". Acta Neuropathologica. 125 (6): 795–813. doi:10.1007/s00401-013-1114-9. PMC 3661926. PMID 23604588.
  2. Dervişoğlu R, Antonschmidt L, Nimerovsky E, Sant V, Kim M, Ryazanov S, et al. (2023). "Anle138b interaction in α-synuclein aggregates by dynamic nuclear polarization NMR". Methods. 214: 18–27. doi:10.1016/j.ymeth.2023.04.002. PMID 37037308.
  3. Antonschmidt L, Matthes D, DervişOğLu R, Frieg B, Dienemann C, Leonov A, et al. (2022). "The clinical drug candidate anle138b binds in a cavity of lipidic α-synuclein fibrils". Nature Communications. 13 (1): 5385. Bibcode:2022NatCo..13.5385A. doi:10.1038/s41467-022-32797-w. PMC 9474542. PMID 36104315.
  4. Wagner J, Krauss S, Shi S, Ryazanov S, Steffen J, Miklitz C, et al. (2015). "Reducing tau aggregates with anle138b delays disease progression in a mouse model of tauopathies". Acta Neuropathologica. 130 (5): 619–631. doi:10.1007/s00401-015-1483-3. PMC 4612332. PMID 26439832.
  5. Martinez Hernandez A, Urbanke H, Gillman AL, Lee J, Ryazanov S, Agbemenyah HY, et al. (2018). "The diphenylpyrazole compound anle138b blocks Aβ channels and rescues disease phenotypes in a mouse model for amyloid pathology". EMBO Molecular Medicine. 10 (1): 32–47. doi:10.15252/emmm.201707825. PMC 5760857. PMID 29208638.
  6. "Emrusolmin - Modag". AdisInsight. Springer Nature Switzerland AG.
Stub icon

This drug article relating to the nervous system is a stub. You can help Misplaced Pages by expanding it.

Categories:
Emrusolmin: Difference between revisions Add topic