Misplaced Pages

Emrusolmin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactivelyNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:30, 24 December 2024 editInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,114 edits new page  Revision as of 13:31, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,450,102 edits Add: page, display-authors, pmc, pmid, pages, issue, volume, journal, date, title, authors 1-30. | Use this bot. Report bugs. | Suggested by Innerstream | #UCB_webformNext edit →
Line 59: Line 59:
}} }}


'''Emrusolmin''' (development code '''Anle138b''') is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of ] which is implicated in the development of ].<ref>{{cite journal | doi = 10.1007/s00401-013-1114-9 | title = Anle138b: A novel oligomer modulator for disease-modifying therapy of neurodegenerative diseases such as prion and Parkinson's disease | date = 2013 | last1 = Wagner | first1 = Jens | last2 = Ryazanov | first2 = Sergey | last3 = Leonov | first3 = Andrei | last4 = Levin | first4 = Johannes | last5 = Shi | first5 = Song | last6 = Schmidt | first6 = Felix | last7 = Prix | first7 = Catharina | last8 = Pan-Montojo | first8 = Francisco | last9 = Bertsch | first9 = Uwe | last10 = Mitteregger-Kretzschmar | first10 = Gerda | last11 = Geissen | first11 = Markus | last12 = Eiden | first12 = Martin | last13 = Leidel | first13 = Fabienne | last14 = Hirschberger | first14 = Thomas | last15 = Deeg | first15 = Andreas A. | last16 = Krauth | first16 = Julian J. | last17 = Zinth | first17 = Wolfgang | last18 = Tavan | first18 = Paul | last19 = Pilger | first19 = Jens | last20 = Zweckstetter | first20 = Markus | last21 = Frank | first21 = Tobias | last22 = Bähr | first22 = Mathias | last23 = Weishaupt | first23 = Jochen H. | last24 = Uhr | first24 = Manfred | last25 = Urlaub | first25 = Henning | last26 = Teichmann | first26 = Ulrike | last27 = Samwer | first27 = Matthias | last28 = Bötzel | first28 = Kai | last29 = Groschup | first29 = Martin | last30 = Kretzschmar | first30 = Hans | journal = Acta Neuropathologica | volume = 125 | issue = 6 | pages = 795–813 | pmid = 23604588 | pmc = 3661926 | display-authors = 1 }}</ref><ref>{{cite journal | doi = 10.1016/j.ymeth.2023.04.002 | title = Anle138b interaction in α-synuclein aggregates by dynamic nuclear polarization NMR | date = 2023 | last1 = Dervişoğlu | first1 = Rıza | last2 = Antonschmidt | first2 = Leif | last3 = Nimerovsky | first3 = Evgeny | last4 = Sant | first4 = Vrinda | last5 = Kim | first5 = Myeongkyu | last6 = Ryazanov | first6 = Sergey | last7 = Leonov | first7 = Andrei | last8 = Fuentes-Monteverde | first8 = Juan Carlos | last9 = Wegstroth | first9 = Melanie | last10 = Giller | first10 = Karin | last11 = Mathies | first11 = Guinevere | last12 = Giese | first12 = Armin | last13 = Becker | first13 = Stefan | last14 = Griesinger | first14 = Christian | last15 = Andreas | first15 = Loren B. | journal = Methods | volume = 214 | pages = 18–27 | pmid = 37037308 }}</ref><ref>{{cite journal | doi = 10.1038/s41467-022-32797-w | title = The clinical drug candidate anle138b binds in a cavity of lipidic α-synuclein fibrils | date = 2022 | last1 = Antonschmidt | first1 = Leif | last2 = Matthes | first2 = Dirk | last3 = DervişOğLu | first3 = Rıza | last4 = Frieg | first4 = Benedikt | last5 = Dienemann | first5 = Christian | last6 = Leonov | first6 = Andrei | last7 = Nimerovsky | first7 = Evgeny | last8 = Sant | first8 = Vrinda | last9 = Ryazanov | first9 = Sergey | last10 = Giese | first10 = Armin | last11 = Schröder | first11 = Gunnar F. | last12 = Becker | first12 = Stefan | last13 = De Groot | first13 = Bert L. | last14 = Griesinger | first14 = Christian | last15 = Andreas | first15 = Loren B. | journal = Nature Communications | volume = 13 | issue = 1 | page = 5385 | pmid = 36104315 | pmc = 9474542 }}</ref> Other proteins it inhibits the aggregation of include ]<ref>{{cite journal | doi = 10.1007/s00401-015-1483-3 | title = Reducing tau aggregates with anle138b delays disease progression in a mouse model of tauopathies | date = 2015 | last1 = Wagner | first1 = Jens | last2 = Krauss | first2 = Sybille | last3 = Shi | first3 = Song | last4 = Ryazanov | first4 = Sergey | last5 = Steffen | first5 = Julia | last6 = Miklitz | first6 = Carolin | last7 = Leonov | first7 = Andrei | last8 = Kleinknecht | first8 = Alexander | last9 = Göricke | first9 = Bettina | last10 = Weishaupt | first10 = Jochen H. | last11 = Weckbecker | first11 = Daniel | last12 = Reiner | first12 = Anne M. | last13 = Zinth | first13 = Wolfgang | last14 = Levin | first14 = Johannes | last15 = Ehninger | first15 = Dan | last16 = Remy | first16 = Stefan | last17 = Kretzschmar | first17 = Hans A. | last18 = Griesinger | first18 = Christian | last19 = Giese | first19 = Armin | last20 = Fuhrmann | first20 = Martin | journal = Acta Neuropathologica | volume = 130 | issue = 5 | pages = 619–631 | pmid = 26439832 | pmc = 4612332 }}</ref> which is associated with ] (AD) and ], and ]<ref>{{cite journal | doi = 10.15252/emmm.201707825 | title = The diphenylpyrazole compound anle138b blocks Aβ channels and rescues disease phenotypes in a mouse model for amyloid pathology | date = 2018 | last1 = Martinez Hernandez | first1 = Ana | last2 = Urbanke | first2 = Hendrik | last3 = Gillman | first3 = Alan L. | last4 = Lee | first4 = Joon | last5 = Ryazanov | first5 = Sergey | last6 = Agbemenyah | first6 = Hope Y. | last7 = Benito | first7 = Eva | last8 = Jain | first8 = Gaurav | last9 = Kaurani | first9 = Lalit | last10 = Grigorian | first10 = Gayane | last11 = Leonov | first11 = Andrei | last12 = Rezaei-Ghaleh | first12 = Nasrollah | last13 = Wilken | first13 = Petra | last14 = Arce | first14 = Fernando Teran | last15 = Wagner | first15 = Jens | last16 = Fuhrman | first16 = Martin | last17 = Caruana | first17 = Mario | last18 = Camilleri | first18 = Angelique | last19 = Vassallo | first19 = Neville | last20 = Zweckstetter | first20 = Markus | last21 = Benz | first21 = Roland | last22 = Giese | first22 = Armin | last23 = Schneider | first23 = Anja | last24 = Korte | first24 = Martin | last25 = Lal | first25 = Ratnesh | last26 = Griesinger | first26 = Christian | last27 = Eichele | first27 = Gregor | last28 = Fischer | first28 = Andre | journal = EMBO Molecular Medicine | volume = 10 | pages = 32–47 | pmid = 29208638 }}</ref> which is associated with AD.
'''Emrusolmin''' (development code '''Anle138b''') is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of ] which is implicated in the development of ].<ref>{{cite journal | doi = 10.1007/s00401-013-1114-9 }}</ref><ref>{{cite journal | doi = 10.1016/j.ymeth.2023.04.002 }}</ref><ref>{{cite journal | doi = 10.1038/s41467-022-32797-w }}</ref> Other proteins it inhibits the aggregation of include ]<ref>{{cite journal | doi = 10.1007/s00401-015-1483-3 }}</ref> which is associated with ] (AD) and ], and ]<ref>{{cite journal | doi = 10.15252/emmm.201707825 }}</ref> which is associated with AD.


It is currently in clinical trials for Parkinson's disease and ].<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800046788 | title = Emrusolmin - Modag | publisher = AdisInsight }}</ref> It is currently in clinical trials for Parkinson's disease and ].<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800046788 | title = Emrusolmin - Modag | publisher = AdisInsight }}</ref>

Revision as of 13:31, 24 December 2024

Pharmaceutical compound
Emrusolmin
200px
Clinical data
Other namesAnle138b, TEV-56286
Legal status
Legal status
  • Investigational
Identifiers
IUPAC name
  • 5-(1,3-Benzodioxol-5-yl)-3-(3-bromophenyl)-1H-pyrazole
CAS Number
PubChem CID
DrugBank
UNII
Chemical and physical data
FormulaC16H11BrN2O2
Molar mass343.180 g·mol
3D model (JSmol)
SMILES
  • C1OC2=C(O1)C=C(C=C2)C3=CC(=NN3)C4=CC(=CC=C4)Br

Emrusolmin (development code Anle138b) is an experimental drug for the treatment of neurodegenerative diseases. It is an inhibitor of protein aggregation, particularly preventing the aggregation of α-synuclein which is implicated in the development of Parkinson's disease. Other proteins it inhibits the aggregation of include tau which is associated with Alzheimer's disease (AD) and tauopathy, and amyloid beta which is associated with AD.

It is currently in clinical trials for Parkinson's disease and multiple system atrophy.

References

  1. Wagner, Jens; et al. (2013). "Anle138b: A novel oligomer modulator for disease-modifying therapy of neurodegenerative diseases such as prion and Parkinson's disease". Acta Neuropathologica. 125 (6): 795–813. doi:10.1007/s00401-013-1114-9. PMC 3661926. PMID 23604588.
  2. Dervişoğlu, Rıza; Antonschmidt, Leif; Nimerovsky, Evgeny; Sant, Vrinda; Kim, Myeongkyu; Ryazanov, Sergey; Leonov, Andrei; Fuentes-Monteverde, Juan Carlos; Wegstroth, Melanie; Giller, Karin; Mathies, Guinevere; Giese, Armin; Becker, Stefan; Griesinger, Christian; Andreas, Loren B. (2023). "Anle138b interaction in α-synuclein aggregates by dynamic nuclear polarization NMR". Methods. 214: 18–27. doi:10.1016/j.ymeth.2023.04.002. PMID 37037308.
  3. Antonschmidt, Leif; Matthes, Dirk; DervişOğLu, Rıza; Frieg, Benedikt; Dienemann, Christian; Leonov, Andrei; Nimerovsky, Evgeny; Sant, Vrinda; Ryazanov, Sergey; Giese, Armin; Schröder, Gunnar F.; Becker, Stefan; De Groot, Bert L.; Griesinger, Christian; Andreas, Loren B. (2022). "The clinical drug candidate anle138b binds in a cavity of lipidic α-synuclein fibrils". Nature Communications. 13 (1): 5385. doi:10.1038/s41467-022-32797-w. PMC 9474542. PMID 36104315.
  4. Wagner, Jens; Krauss, Sybille; Shi, Song; Ryazanov, Sergey; Steffen, Julia; Miklitz, Carolin; Leonov, Andrei; Kleinknecht, Alexander; Göricke, Bettina; Weishaupt, Jochen H.; Weckbecker, Daniel; Reiner, Anne M.; Zinth, Wolfgang; Levin, Johannes; Ehninger, Dan; Remy, Stefan; Kretzschmar, Hans A.; Griesinger, Christian; Giese, Armin; Fuhrmann, Martin (2015). "Reducing tau aggregates with anle138b delays disease progression in a mouse model of tauopathies". Acta Neuropathologica. 130 (5): 619–631. doi:10.1007/s00401-015-1483-3. PMC 4612332. PMID 26439832.
  5. Martinez Hernandez, Ana; Urbanke, Hendrik; Gillman, Alan L.; Lee, Joon; Ryazanov, Sergey; Agbemenyah, Hope Y.; Benito, Eva; Jain, Gaurav; Kaurani, Lalit; Grigorian, Gayane; Leonov, Andrei; Rezaei-Ghaleh, Nasrollah; Wilken, Petra; Arce, Fernando Teran; Wagner, Jens; Fuhrman, Martin; Caruana, Mario; Camilleri, Angelique; Vassallo, Neville; Zweckstetter, Markus; Benz, Roland; Giese, Armin; Schneider, Anja; Korte, Martin; Lal, Ratnesh; Griesinger, Christian; Eichele, Gregor; Fischer, Andre (2018). "The diphenylpyrazole compound anle138b blocks Aβ channels and rescues disease phenotypes in a mouse model for amyloid pathology". EMBO Molecular Medicine. 10: 32–47. doi:10.15252/emmm.201707825. PMID 29208638.
  6. "Emrusolmin - Modag". AdisInsight.
Stub icon

This drug article relating to the nervous system is a stub. You can help Misplaced Pages by expanding it.

Categories:
Emrusolmin: Difference between revisions Add topic