Misplaced Pages

Evobrutinib: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactivelyNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:37, 24 December 2024 editInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,114 edits new page  Revision as of 15:37, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,450,099 edits Add: pmc, pmid, pages, issue, volume, journal, date, title, authors 1-20. | Use this bot. Report bugs. | Suggested by Innerstream | #UCB_toolbarNext edit →
Line 59: Line 59:
}} }}


'''Evobrutinib''' is an experimental drug being studied for the treatment of ] and ].<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800041955 | title = Evobrutinib | publisher = AdisInsight }}</ref><ref>{{cite journal | doi = 10.1177/13524585241234783 }}</ref><ref>{{cite journal | doi = 10.1016/S1474-4422(24)00328-4 }}</ref> It is an ] of ].<ref>{{cite web | url = https://mstrust.org.uk/a-z/evobrutinib | title = Evobrutinib | publisher = Multiple Sclerosis Trust }}</ref> '''Evobrutinib''' is an experimental drug being studied for the treatment of ] and ].<ref>{{cite web | url = https://adisinsight.springer.com/drugs/800041955 | title = Evobrutinib | publisher = AdisInsight }}</ref><ref>{{cite journal | doi = 10.1177/13524585241234783 | title = Efficacy and safety results after >3.5 years of treatment with the Bruton's tyrosine kinase inhibitor evobrutinib in relapsing multiple sclerosis: Long-term follow-up of a Phase II randomised clinical trial with a cerebrospinal fluid sub-study | date = 2024 | last1 = Montalban | first1 = Xavier | last2 = Piasecka-Stryczynska | first2 = Karolina | last3 = Kuhle | first3 = Jens | last4 = Benkert | first4 = Pascal | last5 = Arnold | first5 = Douglas L. | last6 = Weber | first6 = Martin S. | last7 = Seitzinger | first7 = Andrea | last8 = Guehring | first8 = Hans | last9 = Shaw | first9 = Jamie | last10 = Tomic | first10 = Davorka | last11 = Hyvert | first11 = Yann | last12 = Harlow | first12 = Danielle E. | last13 = Dyroff | first13 = Martin | last14 = Wolinsky | first14 = Jerry S. | journal = Multiple Sclerosis Journal | volume = 30 | issue = 4–5 | pages = 558–570 | pmid = 38436271 | pmc = 11080380 }}</ref><ref>{{cite journal | doi = 10.1016/S1474-4422(24)00328-4 | title = Safety and efficacy of evobrutinib in relapsing multiple sclerosis (EvolutionRMS1 and evolutionRMS2): Two multicentre, randomised, double-blind, active-controlled, phase 3 trials | date = 2024 | last1 = Montalban | first1 = Xavier | last2 = Vermersch | first2 = Patrick | last3 = Arnold | first3 = Douglas L. | last4 = Bar-Or | first4 = Amit | last5 = Cree | first5 = Bruce A C. | last6 = Cross | first6 = Anne H. | last7 = Kubala Havrdova | first7 = Eva | last8 = Kappos | first8 = Ludwig | last9 = Stuve | first9 = Olaf | last10 = Wiendl | first10 = Heinz | last11 = Wolinsky | first11 = Jerry S. | last12 = Dahlke | first12 = Frank | last13 = Le Bolay | first13 = Claire | last14 = Shen Loo | first14 = Li | last15 = Gopalakrishnan | first15 = Sathej | last16 = Hyvert | first16 = Yann | last17 = Javor | first17 = Andrija | last18 = Guehring | first18 = Hans | last19 = Tenenbaum | first19 = Nadia | last20 = Tomic | first20 = Davorka | journal = The Lancet Neurology | volume = 23 | issue = 11 | pages = 1119–1132 | pmid = 39307151 }}</ref> It is an ] of ].<ref>{{cite web | url = https://mstrust.org.uk/a-z/evobrutinib | title = Evobrutinib | publisher = Multiple Sclerosis Trust }}</ref>


==References== ==References==

Revision as of 15:37, 24 December 2024

Pharmaceutical compound
Evobrutinib
Legal status
Legal status
  • Investigational
Identifiers
CAS Number
PubChem CID
DrugBank
UNII
KEGG
Chemical and physical data
FormulaC25H27N5O2
Molar mass429.524 g·mol
3D model (JSmol)
SMILES
  • C=CC(=O)N1CCC(CC1)CNC2=NC=NC(=C2C3=CC=C(C=C3)OC4=CC=CC=C4)N

Evobrutinib is an experimental drug being studied for the treatment of encephalomyelitis and multiple sclerosis. It is an inhibitor of Bruton's tyrosine kinase.

References

  1. "Evobrutinib". AdisInsight.
  2. Montalban, Xavier; Piasecka-Stryczynska, Karolina; Kuhle, Jens; Benkert, Pascal; Arnold, Douglas L.; Weber, Martin S.; Seitzinger, Andrea; Guehring, Hans; Shaw, Jamie; Tomic, Davorka; Hyvert, Yann; Harlow, Danielle E.; Dyroff, Martin; Wolinsky, Jerry S. (2024). "Efficacy and safety results after >3.5 years of treatment with the Bruton's tyrosine kinase inhibitor evobrutinib in relapsing multiple sclerosis: Long-term follow-up of a Phase II randomised clinical trial with a cerebrospinal fluid sub-study". Multiple Sclerosis Journal. 30 (4–5): 558–570. doi:10.1177/13524585241234783. PMC 11080380. PMID 38436271.
  3. Montalban, Xavier; Vermersch, Patrick; Arnold, Douglas L.; Bar-Or, Amit; Cree, Bruce A C.; Cross, Anne H.; Kubala Havrdova, Eva; Kappos, Ludwig; Stuve, Olaf; Wiendl, Heinz; Wolinsky, Jerry S.; Dahlke, Frank; Le Bolay, Claire; Shen Loo, Li; Gopalakrishnan, Sathej; Hyvert, Yann; Javor, Andrija; Guehring, Hans; Tenenbaum, Nadia; Tomic, Davorka (2024). "Safety and efficacy of evobrutinib in relapsing multiple sclerosis (EvolutionRMS1 and evolutionRMS2): Two multicentre, randomised, double-blind, active-controlled, phase 3 trials". The Lancet Neurology. 23 (11): 1119–1132. doi:10.1016/S1474-4422(24)00328-4. PMID 39307151.
  4. "Evobrutinib". Multiple Sclerosis Trust.
Categories:
Evobrutinib: Difference between revisions Add topic