Misplaced Pages

Evobrutinib: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:38, 24 December 2024 editInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,114 editsNo edit summary← Previous edit Revision as of 19:29, 24 December 2024 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,879 edits added missing data to drug boxTag: nowiki addedNext edit →
Line 1: Line 1:

{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug {{Infobox drug
| drug_name = | drug_name =
| INN = | INN =
| type = <!-- empty --> | type = <!-- empty -->
| image = Evobrutinib.svg | image =
⚫ | width =
| alt = | alt =
| caption = | caption =
⚫ | image2 =
⚫ | width2 =
| alt2 =
| caption2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| captionLR =

<!-- Clinical data --> <!-- Clinical data -->
| pronounce = | pronounce =
Line 11: Line 26:
| Drugs.com = | Drugs.com =
| MedlinePlus = | MedlinePlus =
| licence_CA =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment = | pregnancy_AU_comment =
| pregnancy_category= | pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration = | routes_of_administration =
| class =
| ATCvet = | ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised --> | ATC_prefix =
| ATC_suffix = | ATC_suffix =
| ATC_supplemental =

<!-- Legal status --> <!-- Legal status -->
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled -->
Line 38: Line 62:
| legal_UN_comment = | legal_UN_comment =
| legal_status = Investigational | legal_status = Investigational

<!-- Pharmacokinetic data --> <!-- Pharmacokinetic data -->
| bioavailability = | bioavailability =
Line 47: Line 72:
| duration_of_action= | duration_of_action=
| excretion = | excretion =

<!-- Identifiers --> <!-- Identifiers -->
| CAS_number = 1415823-73-2 | CAS_number = 1415823-73-2
| CAS_supplemental =
| PubChem = 71479709 | PubChem = 71479709
| PubChemSubstance =
⚫ | UNII = ZA45457L1K
| KEGG = D12467 | IUPHAR_ligand =
| DrugBank = DB15170 | DrugBank = DB15170
| ChemSpiderID =
| UNII = ZA45457L1K
| KEGG = D12467
| ChEBI =
| ChEMBL = 4072833
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =

<!-- Chemical and physical data --> <!-- Chemical and physical data -->
| IUPAC_name = <nowiki>1-amino]methyl]piperidin-1-yl]prop-2-en-1-one</nowiki>
⚫ | IUPAC_name =
| C=25 | H=27 | N=5 | O=2
⚫ | smiles = C=CC(=O)N1CCC(CC1)CNC2=NC=NC(=C2C3=CC=C(C=C3)OC4=CC=CC=C4)N
| molecular_weight =
⚫ | C = 25 | H = 27 | N = 5 | O = 2
⚫ | SMILES = C=CC(=O)N1CCC(CC1)CNC2=NC=NC(=C2C3=CC=C(C=C3)OC4=CC=CC=C4)N
| Jmol =
| StdInChI = InChI=1S/C25H27N5O2/c1-2-22(31)30-14-12-18(13-15-30)16-27-25-23(24(26)28-17-29-25)19-8-10-21(11-9-19)32-20-6-4-3-5-7-20/h2-11,17-18H,1,12-16H2,(H3,26,27,28,29)
| StdInChI_comment =
| StdInChIKey = QUIWHXQETADMGN-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}} }}


Revision as of 19:29, 24 December 2024

Pharmaceutical compound
Evobrutinib
Legal status
Legal status
  • Investigational
Identifiers
IUPAC name
  • 1-amino]methyl]piperidin-1-yl]prop-2-en-1-one
CAS Number
PubChem CID
DrugBank
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC25H27N5O2
Molar mass429.524 g·mol
3D model (JSmol)
SMILES
  • C=CC(=O)N1CCC(CC1)CNC2=NC=NC(=C2C3=CC=C(C=C3)OC4=CC=CC=C4)N
InChI
  • InChI=InChI=1S/C25H27N5O2/c1-2-22(31)30-14-12-18(13-15-30)16-27-25-23(24(26)28-17-29-25)19-8-10-21(11-9-19)32-20-6-4-3-5-7-20/h2-11,17-18H,1,12-16H2,(H3,26,27,28,29)
  • Key:QUIWHXQETADMGN-UHFFFAOYSA-N

Evobrutinib is an experimental drug being studied for the treatment of encephalomyelitis and multiple sclerosis. It is an inhibitor of Bruton's tyrosine kinase.

References

  1. "Evobrutinib". AdisInsight.
  2. Montalban X, Piasecka-Stryczynska K, Kuhle J, Benkert P, Arnold DL, Weber MS, et al. (2024). "Efficacy and safety results after >3.5 years of treatment with the Bruton's tyrosine kinase inhibitor evobrutinib in relapsing multiple sclerosis: Long-term follow-up of a Phase II randomised clinical trial with a cerebrospinal fluid sub-study". Multiple Sclerosis Journal. 30 (4–5): 558–570. doi:10.1177/13524585241234783. PMC 11080380. PMID 38436271.
  3. Montalban X, Vermersch P, Arnold DL, Bar-Or A, Cree BA, Cross AH, et al. (2024). "Safety and efficacy of evobrutinib in relapsing multiple sclerosis (EvolutionRMS1 and evolutionRMS2): Two multicentre, randomised, double-blind, active-controlled, phase 3 trials". The Lancet Neurology. 23 (11): 1119–1132. doi:10.1016/S1474-4422(24)00328-4. PMID 39307151.
  4. "Evobrutinib". Multiple Sclerosis Trust.
Stub icon

This antineoplastic or immunomodulatory drug article is a stub. You can help Misplaced Pages by expanding it.

Categories:
Evobrutinib: Difference between revisions Add topic