| Revision as of 12:41, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 465878792 of page Tetrahydrozoline for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 12:42, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 451347170 of page Tetrakis(dimethylamido)titanium for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
|
| Name = Tetrakis(dimethylamino)titanium<br /> |
|
| verifiedrevid = 459591813 |
|
|
|
(IV) |
|
|ImageFile=Tetrahydrozoline-2D-skeletal.svg |
|
|
|
| ImageFile = Ti(NMe2)4.png |
|
|ImageSize=150px |
|
| ImageSize = 150px |
|
|IUPACName= (''RS'')-2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1''H''-imidazole |
|
|
|
| ImageName = Stereo wireframe model of tetrakis(dimethylamino)titanium(IV) |
|
|OtherNames= |
|
|
|
| PIN = Tetrakis(dimethylamino)titanium(IV) |
|
|
| SystematicName = Dimethylamine |
|
|
| OtherNames = Titanium(IV) dimethylamide |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = TDMAT |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 3275-24-9 --> |
| ⚫ |
| ChemSpiderID = 5226 |
|
|
⚫ |
| PubChem = 123185 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
|
| PubChem_Ref = {{Pubchemcite}} |
|
| KEGG = D08578 |
|
|
⚫ |
| ChemSpiderID = 13870283 |
|
| InChI = 1/C13H16N2/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13/h1-2,4,6,12H,3,5,7-9H2,(H,14,15) |
|
|
⚫ |
| ChemSpiderID_Ref = {{Chemspidercite}} |
|
| InChIKey = BYJAVTDNIXVSPW-UHFFFAOYAC |
|
|
|
| EINECS = 221-904-3 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1266 |
|
| UNNumber = 2924<br /> |
|
|
3398 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C13H16N2/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13/h1-2,4,6,12H,3,5,7-9H2,(H,14,15) |
|
| StdInChI = 1S/4C2H6N.Ti/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
|
⚫ |
| StdInChIKey = MNWRORMXBIWXCI-UHFFFAOYSA-N |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| SMILES = CN(C)(N(C)C)(N(C)C)N(C)C |
| ⚫ |
| StdInChIKey = BYJAVTDNIXVSPW-UHFFFAOYSA-N |
|
|
|
| InChI = 1S/4C2H6N.Ti/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
|
|
| InChIKey = MNWRORMXBIWXCI-UHFFFAOYSA-N}} |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 84-22-0 --> |
|
|
⚫ |
| Section2 = {{Chembox Properties |
| ⚫ |
| PubChem=5419 |
|
|
⚫ |
| Formula = C<sub>8</sub>H<sub>24</sub>N<sub>4</sub>Ti |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
⚫ |
| MolarMass = 224.19 g/mol |
|
| UNII = S9U025Y077 |
|
|
⚫ |
| Appearance = yellow liquid |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
⚫ |
| Density = 0.947 g/cm³ |
|
| ChEBI = 28674 |
|
|
⚫ |
| Solubility = reacts with water |
|
| SMILES = N\1=C(\NCC/1)C3c2ccccc2CCC3 |
|
|
|
| BoilingPt = 50 °C at 0.05mmHg |
|
}} |
|
| ⚫ |
|Section2= {{Chembox Properties |
|
| ⚫ |
| Formula=C<sub>13</sub>H<sub>16</sub>N<sub>2</sub> |
|
| ⚫ |
| MolarMass=200.28 g/mol |
|
| ⚫ |
| Appearance= |
|
| ⚫ |
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
| ⚫ |
| Solubility= |
|
|
}} |
|
}} |
|
|
|
|
|Section3= {{Chembox Hazards |
|
| Section7 = {{Chembox Hazards |
|
| MainHazards= |
|
|
| FlashPt= |
|
| EUClass = ? |
|
| Autoignition= |
|
| NFPA-H = 3 |
|
|
| NFPA-F = 3 |
|
|
| NFPA-R = 2 |
|
|
| RPhrases = 11-14-34| SPhrases = 16 - 26 - 36/37/39 - 43 - 45 |
|
}} |
|
}} |
|
}} |
|
}} |
4.png)
