Pipramadol - Misplaced Pages

This is an old revision of this page, as edited by Mo18ekula (talk | contribs) at 11:44, 17 December 2024 (←Created page with '{{Infobox drug | drug_name = Pipramadol | image = Pipramadol.svg | width = 250px | caption =  | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATC_prefix = | ATC_suffix =  | legal_status = <!-- Phar...'). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

Revision as of 11:44, 17 December 2024 by Mo18ekula (talk | contribs) (←Created page with '{{Infobox drug | drug_name = Pipramadol | image = Pipramadol.svg | width = 250px | caption =  | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATC_prefix = | ATC_suffix =  | legal_status = <!-- Phar...')(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff) Pharmaceutical compound

Pipramadol
Clinical data

Other names	FQ 27-096
Identifiers
IUPAC name 2--4-hydroxypiperidin-4-yl]-N-cyclohexyl-N-methylpropanamide
ChemSpider	2310156
CompTox Dashboard (EPA)	DTXSID40866480
Chemical and physical data
Formula	C₂₃H₃₅ClN₂O₂
Molar mass	407.00 g·mol
3D model (JSmol)	Interactive image
SMILES CC(C(=O)N(C)C1CCCCC1)C2(CCN(CC2)CCC3=CC=CC=C3Cl)O
InChI InChI=1S/C23H35ClN2O2/c1-18(22(27)25(2)20-9-4-3-5-10-20)23(28)13-16-26(17-14-23)15-12-19-8-6-7-11-21(19)24/h6-8,11,18,20,28H,3-5,9-10,12-17H2,1-2H3 Key:JRLWHJKUNYBJRC-UHFFFAOYSA-N

Pipramadol is an opioid narcotic with potent analgesic properties.

Review:

References

Huegi, Bruno S.; Ebnoether, Anton M.; Rissi, Erwin; Gadient, Fulvio; Hauser, Daniel; Roemer, Dietmar; Buescher, Heinz H.; Petcher, Trevor J. (1983). "Synthesis and pharmacological studies of 4,4-disubstituted piperidines: a new class of compounds with potent analgesic properties". Journal of Medicinal Chemistry 26 (1): 42–50. doi:10.1021/jm00355a010.
Kurbat, N. M.; Praliev, K. D.; Salita, T. A.; Yu, V. K.; Verina, E. L. (1991). "Neuropharmacological activity of piperidine derivatives (a review)". Pharmaceutical Chemistry Journal. 25 (7): 450–462. doi:10.1007/BF00771998.

Opioid receptor modulators

μ-opioid
(MOR)

Agonists
(abridged;
full list)