| Revision as of 18:12, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,045 edits Saving copy of the {{chembox}} taken from revid 443352618 of page 4-Diphosphocytidyl-2-C-methylerythritol for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 14:16, 27 April 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443351241 |
|
| verifiedrevid = 477221682 |
|
|ImageFile=4-diphosphocytidyl-2-C-methylerythritol.png |
|
| ImageFile=4-diphosphocytidyl-2-C-methylerythritol.png |
|
|ImageSize=250px |
|
| ImageSize=250px |
| ⚫ |
|IUPACName= <small>methyl phosphoryl] hydrogen phosphate</small> |
|
|
|
| IUPACName=Cytidine 5′-(1-deoxy-2-''C''-methyl-<small>D</small>-erythritol-1-yl dihydrogen diphosophate) |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| PIN=''O''<sup>1</sup>-<nowiki/>{methyl} ''O''<sup>3</sup>- dihydrogen diphosphate |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 391471 |
|
| ChemSpiderID = 391471 |
|
| InChI = 1/C14H25N3O14P2/c1-14(23,6-18)8(19)5-29-33(26,27)31-32(24,25)28-4-7-10(20)11(21)12(30-7)17-3-2-9(15)16-13(17)22/h2-3,7-8,10-12,18-21,23H,4-6H2,1H3,(H,24,25)(H,26,27)(H2,15,16,22)/t7-,8-,10-,11-,12-,14+/m1/s1 |
|
| InChI = 1/C14H25N3O14P2/c1-14(23,6-18)8(19)5-29-33(26,27)31-32(24,25)28-4-7-10(20)11(21)12(30-7)17-3-2-9(15)16-13(17)22/h2-3,7-8,10-12,18-21,23H,4-6H2,1H3,(H,24,25)(H,26,27)(H2,15,16,22)/t7-,8-,10-,11-,12-,14+/m1/s1 |
| Line 16: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YFAUKWZNPVBCFF-XHIBXCGHSA-N |
|
| StdInChIKey = YFAUKWZNPVBCFF-XHIBXCGHSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 263016-94-0 --> |
|
|
|
| CASNo=263016-94-0 |
|
| PubChem=443199 |
|
| PubChem=443199 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 16578 |
|
| ChEBI = 16578 |
|
| SMILES=C(CO)((COP(=O)(O)OP(=O)(O)OC1(((O1)N2C=CC(=NC2=O)N)O)O)O)O |
|
| SMILES=C(CO)((COP(=O)(O)OP(=O)(O)OC1(((O1)N2C=CC(=NC2=O)N)O)O)O)O |
|
| MeSHName=4-diphosphocytidyl-2-C-methylerythritol |
|
| MeSHName=4-diphosphocytidyl-2-C-methylerythritol |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>14</sub>H<sub>25</sub>N<sub>3</sub>O<sub>14</sub>P<sub>2</sub> |
|
| Formula=C<sub>14</sub>H<sub>25</sub>N<sub>3</sub>O<sub>14</sub>P<sub>2</sub> |
|
| MolarMass=521.31 g/mol |
|
| MolarMass=521.31 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''4-Diphosphocytidyl-2-''C''-methylerythritol''' (or '''CDP-ME''') is an intermediate in the ] (non-mevalonate pathway) of ] precursor biosynthesis. It is produced by the enzyme ] and is a substrate for ]. |
|
|
|
|
|
{{Cholesterol metabolism intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Diphosphocytidyl-2-C-methylerythritol, 4-}} |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |