| Revision as of 20:13, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 469769812 of page Aescin for the Chem/Drugbox validation project (updated: 'KEGG', 'CASNo'). |
Latest revision as of 12:36, 24 January 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,057 edits Used lowercase "cite" template everywhere for consistency. |
| Line 1: |
Line 1: |
|
|
{{short description|Main active component in horse chestnut}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
|
{{distinguish|text=], an unrelated ] glycoside also found in horse chestnut}} |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 456667131 |
|
| verifiedrevid = 477243157 |
|
|Name=β-Aescin (main component) |
|
|
|ImageFile=Beta-Aescin.svg |
|
| Name=β-Aescin (main component) |
|
|
| ImageFile=Beta-Aescin.svg |
|
|ImageSize=280 |
|
| ImageSize=280 |
| ⚫ |
|IUPACName=(2''S'',3''S'',4''S'',5''R'',6''R'')-6-{-1,2,3,4a,5,6,7,<br>8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy}-4-hydroxy-<br>3,5-bis{oxy}-2-tetrahydropyrancarboxylic acid |
|
|
|
| IUPACName=β-<small>D</small>-Glucopyranosyl-(1→2)--(22α-(acetyloxy)-16α,24,28-trihydroxy-21β-<nowiki/>{oxy}olean-12-en-3β-yl β-<small>D</small>-glucopyranosiduronic acid) |
| ⚫ |
|OtherNames=Escin |
|
|
⚫ |
| SystematicName=(2''S'',3''S'',4''S'',5''R'',6''R'')-6-{oxy}-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-yl]oxy}-4-hydroxy-3,5-bis{oxy}oxane-2-carboxylic acid |
|
⚫ |
| OtherNames=Escin |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4977652 |
|
| ChemSpiderID = 4977652 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| Line 19: |
Line 23: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = AXNVHPCVMSNXNP-OXPBSUTMSA-N |
|
| StdInChIKey = AXNVHPCVMSNXNP-OXPBSUTMSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 6805-41-0 --> |
|
| CASNo=6805-41-0 |
|
|
| CASNo_Comment = Aescin |
| ⚫ |
| PubChem=6476031 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo1=11072-93-8 |
|
| KEGG = <!-- blanked - oldvalue: C08921 --> |
|
|
|
| CASNo1_Comment = β-Aescin |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
⚫ |
| PubChem=6476031 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG=C08921 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = RUU8G67GQM |
|
| UNII = RUU8G67GQM |
|
|
| UNII_Comment = Aescin |
|
|
| UNII1_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII1 = QYK0D6H79O |
|
|
| UNII1_Comment = β-Aescin |
|
| SMILES=CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)CO)OC(=O)C |
|
| SMILES=CC=C(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)CO)O)O)O)C)CO)OC(=O)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=55|H=86|O=24 |
|
| C=55 | H=86 | O=24 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Aescin''' or '''escin''' is a mixture of ]s with ], ] and ] effects found in '']'' (the horse chestnut). Aescin is the main active component in horse chestnut, and is responsible for most of its medicinal properties. The main active compound of aescin is '''β-aescin''', although the mixture also contains various other components including α-aescin, ], ], ] and ]s.<ref>{{cite book |last1=Ramelet |first1=Albert-Adrien |title=Sclerotherapy: treatment of varicose and telangiectatic leg veins |publisher=Elsevier Science Health Science |isbn=978-0-323-37726-3 |chapter=Venoactive Drugs|date=24 November 2016 |pages=426–434 |edition=6th}}</ref> |
|
|
|
|
|
Evidence suggests that aescin, especially pure β-aescin, is a safe and effective treatment for short-term treatment of ];<ref>{{cite book|last=Goldman, Mitchel P.|title=Sclerotherapy : treatment of varicose and telangiectatic leg veins|date=2016|publisher=Elsevier Science Health Science|others=Weiss, Robert A.,, Guex, Jean-Jerome|isbn=978-0-323-37727-0|edition=6th|location=Amsterdam|oclc=959274899}}</ref><ref name=Pittler2012>{{cite journal|last1=Pittler|first1=Max H.|last2=Ernst|first2=Edzard|date=2012-11-14|title=Horse chestnut seed extract for chronic venous insufficiency|journal=The Cochrane Database of Systematic Reviews|volume=11|issue=11 |pages=CD003230|doi=10.1002/14651858.CD003230.pub4|issn=1469-493X|pmid=23152216|pmc=7144685}}</ref> however, more high quality randomized controlled trials are required to confirm the effectiveness.<ref name=Pittler2012 /> Horse chestnut extract may be as effective and well tolerated as the use of ].<ref name=Pittler2012 /> |
|
|
|
|
|
==Mechanism of action== |
|
|
Aescin appears to produce effects through a wide range of mechanisms. It induces ] by making ]s more permeable to ] ions, and also induces release of ].<ref name=Sirtori>{{cite journal |author =Sirtori CR |title=Aescin: pharmacology, pharmacokinetics and therapeutic profile |journal=Pharmacol. Res. |volume=44 |issue=3 |pages=183–193 |date=September 2001 |pmid=11529685 |doi=10.1006/phrs.2001.0847 }}</ref><ref>{{cite journal |vauthors =Carrasco OF, Vidrio H |title=Endothelium protectant and contractile effects of the antivaricose principle escin in rat aorta |journal=Vascul. Pharmacol. |volume=47 |issue=1 |pages=68–73 |date=July 2007 |pmid=17512261 |doi=10.1016/j.vph.2007.04.003 }}</ref><ref>{{cite journal |vauthors =Berti F, Omini C, Longiave D |title=The mode of action of aescin and the release of prostaglandins |journal=Prostaglandins |volume=14 |issue=2 |pages=241–249 |date=August 1977 |pmid=897216 |doi= 10.1016/0090-6980(77)90169-1}}</ref> Other possible mechanisms include ] and ] and reduced ] of tissue ].<ref name=Sirtori/> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
|
* from ] |
|
|
*{{PubChem|76967409}} - alpha-Aescin |
|
|
|
|
|
] |
|
|
] |
|
|
] |