| Revision as of 14:47, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 471405811 of page Binapacryl for the Chem/Drugbox validation project (updated: 'KEGG', 'CASNo'). |
Latest revision as of 22:18, 7 January 2024 edit Michael7604 (talk | contribs)Extended confirmed users8,895 edits recategorized from Nitrobenzenes to Nitrobenzene derivatives |
| Line 1: |
Line 1: |
|
|
{{Chembox |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
| Verifiedfields = changed |
|
{{chembox |
|
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443423035 |
|
| verifiedrevid = 477372684 |
|
| Reference = <ref name=inchem> from International Programme on Chemical Safety</ref> |
|
| Reference = <ref name=inchem> from International Programme on Chemical Safety</ref> |
|
| ImageFile=Binapacryl.png |
|
| ImageFile =Binapacryl.png |
|
| ImageSize=180px |
|
|
|
| ImageSize =180px |
|
| IUPACName=(''RS'')-(2-Butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate |
|
| PIN = 2-(Butan-2-yl)-4,6-dinitrophenyl 3-methylbut-2-enoate |
|
| OtherNames=Dapacryl; Morocide; Morrocid; Acricid; Endosan; Ambox; Dinoseb methacrylate |
|
|
|
| OtherNames =2--4,6-dinitrophenyl 3-methylbut-2-enoate<br />(''RS'')-2-(Butan-2-yl)-4,6-dinitrophenyl 3-methylbut-2-enoate<br />(''RS'')-2-''sec''-Butyl-4,6-dinitrophenyl 3-methylbut-2-enoate<br />Dapacryl<br />Morocide<br />Morrocid<br />Acricid<br />Endosan<br />Ambox<br />Dinoseb methacrylate |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 485-31-4 --> |
|
|
|
| CASNo =485-31-4 |
|
| PubChem=10234 |
|
|
|
| PubChem =10234 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG = <!-- blanked - oldvalue: C19022 --> |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| KEGG = C19022 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 4X685BB13A |
|
| UNII = 4X685BB13A |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9817 |
|
| ChemSpiderID = 9817 |
| ⚫ |
| SMILES = O=C(Oc1c(cc(cc1C(C)CC)()=O)()=O)\C=C(/C)C |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| InChI = 1/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
|
|
|
| ChEBI = 82153 |
| ⚫ |
| InChIKey = ZRDUSMYWDRPZRM-UHFFFAOYAH |
|
|
|
| ChEMBL = 3182974 |
| ⚫ |
| StdInChI = 1S/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
|
|
|
| EC_number = 207-612-9 |
| ⚫ |
| StdInChIKey = ZRDUSMYWDRPZRM-UHFFFAOYSA-N |
|
|
|
| RTECS = GQ5600000 |
|
|
| UNNumber = 2779 |
|
⚫ |
| SMILES = O=C(Oc1c(cc(cc1C(C)CC)()=O)()=O)\C=C(/C)C |
|
⚫ |
| InChI = 1/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
|
⚫ |
| InChIKey = ZRDUSMYWDRPZRM-UHFFFAOYAH |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = ZRDUSMYWDRPZRM-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=15|H=18|N=2|O=6 |
|
| C=15 | H=18 | N=2 | O=6 |
|
| Appearance= |
|
| Appearance = |
|
| Density=1.2 g/cm<sup>3</sup> |
|
| Density =1.2 g/cm<sup>3</sup> |
|
|
| MeltingPtC = 66 to 67 |
|
| MeltingPt=66-67 °C |
|
|
|
| MeltingPt_notes = |
|
| BoilingPt= |
|
|
| Solubility=Insoluble |
|
| BoilingPt = |
|
|
| Solubility =Insoluble |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
| RPhrases = {{R21/22}} {{R50/53}} {{R61}} |
|
| GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}} |
|
|
| GHSSignalWord = Danger |
|
| SPhrases = {{S45}} {{S53}} {{S60}} {{S61}} |
|
|
|
| HPhrases = {{H-phrases|302|312|360|410}} |
|
|
| PPhrases = {{P-phrases|201|202|264|270|273|280|281|301+312|302+352|308+313|312|322|330|363|391|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Binapacryl''' was used as a ] and ]. Chemically, it is an ] derivative of ]. Although binapacryl has low toxicity itself, it is readily ] to form dinoseb, which is highly toxic.<ref name=inchem/> |
|
|
|
|
|
International trade in binapacryl is regulated by the ]; it has been withdrawn as a pesticide, since products were highly toxic to mammals, fish and aquatic invertebrates.<ref></ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |