| Revision as of 17:37, 4 January 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Category:Natural polyphenols← Previous edit |
Latest revision as of 07:33, 7 January 2022 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,706,096 editsm Moving Category:O-Methylated natural phenols to Category:O-methylated natural phenols per Misplaced Pages:Categories for discussion/Speedy |
| (35 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 405921416 |
|
| ImageFile = Calphostin C.png |
|
| ImageFile = Calphostin C.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = -2,6,7,11-tetramethoxy-4,9-dioxoperylen-1-yl]propan-2-yl] benzoate |
|
| IUPACName = -2,6,7,11-tetramethoxy-4,9-dioxoperylen-1-yl]propan-2-yl] benzoate |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 5156 |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 121263-19-2 |
|
| CASNo = 121263-19-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = I271P23G24 |
|
| PubChem = 10930781 |
|
| PubChem = 10930781 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| SMILES = C(CC1=C(C(=C2C(=O)C=C(C3=C4C(=CC(=O)C5=C(C(=C(C(=C45)C1=C32)C(C)OC(=O)OC6=CC=C(C=C6)O)OC)O)OC)OC)O)OC)OC(=O)C7=CC=CC=C7}} |
|
|
|
| ChEMBL = 1256495 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| C=44|H=38|O=14 |
|
|
| Appearance = |
|
| ChemSpiderID = 9106020 |
|
|
| InChI = 1/C44H38O14/c1-20(56-43(50)22-10-8-7-9-11-22)16-25-31-32-26(17-21(2)57-44(51)58-24-14-12-23(45)13-15-24)42(55-6)40(49)34-28(47)19-30(53-4)36(38(32)34)35-29(52-3)18-27(46)33(37(31)35)39(48)41(25)54-5/h7-15,18-21,45,48-49H,16-17H2,1-6H3/t20-,21-/m1/s1 |
|
|
| InChIKey = LSUTUUOITDQYNO-NHCUHLMSBH |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C44H38O14/c1-20(56-43(50)22-10-8-7-9-11-22)16-25-31-32-26(17-21(2)57-44(51)58-24-14-12-23(45)13-15-24)42(55-6)40(49)34-28(47)19-30(53-4)36(38(32)34)35-29(52-3)18-27(46)33(37(31)35)39(48)41(25)54-5/h7-15,18-21,45,48-49H,16-17H2,1-6H3/t20-,21-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = LSUTUUOITDQYNO-NHCUHLMSSA-N |
|
⚫ |
| SMILES = C(CC1=C(C(=C2C(=O)C=C(C3=C4C(=CC(=O)C5=C(C(=C(C(=C45)C1=C32)C(C)OC(=O)OC6=CC=C(C=C6)O)OC)O)OC)OC)O)OC)OC(=O)C7=CC=CC=C7 |
|
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| C=44 | H=38 | O=14 |
|
|
| Appearance = red to brown powder |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = |
|
|
| LogP = 7.65 |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| pKa = 5.46 |
|
|
}} |
|
⚫ |
|Section7={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
|
}} |
|
⚫ |
'''Calphostin C''' is a natural chemical compound. It is one of the ]s, isolated from the fungus '']''.<ref>{{Cite journal | journal = J. Antibiot. | year = 1989 | volume = 42 | pages = 1470–1474 | author1 = Kobayashi, E | author2 = Ando, K | author3 = Nakano, H | author4 = Iida, T | author5 = Ohno, H | author6 = Morimoto, M | author7 = Tamaoki, T | pmid = 2478514 | title = Calphostins (UCN-1028), novel and specific inhibitors of protein kinase C. I. Fermentation, isolation, physico-chemical properties and biological activities | issue = 10 | doi=10.7164/antibiotics.42.1470| doi-access = free }}</ref><ref>{{cite journal | journal = J. Antibiot. | year = 1989 | volume = 42 | pages = 1475–1481 | author1 = Iida, T | author2 = Kobayashi, E | author3 = Yoshida, M | author4 = Sano, H | pmid = 2478515 | title = Calphostins, novel and specific inhibitors of protein kinase C. II. Chemical structures | issue = 10 | doi=10.7164/antibiotics.42.1475| doi-access = free }}</ref> Calphostin C is a potent ] of ] (PKC). |
|
|
|
|
|
⚫ |
== References == |
| ⚫ |
'''Calphostin C''' is a natural chemical compound. It is one of the ]s, isolated from the fungus '']''.<ref>{{Cite journal | journal = J. Antibiot | year = 1989 | volume = 42 | pages = 1470–1474 | author1 = Kobayashi, E | author2 = Ando, K | author3 = Nakano, H | author4 = Iida, T | author5 = Ohno, H | author6 = Morimoto, M | author7 = Tamaoki, T | pmid = 2478514 | title = Calphostins (UCN-1028), novel and specific inhibitors of protein kinase C. I. Fermentation, isolation, physico-chemical properties and biological activities | issue = 10}}</ref><ref>{{cite journal | journal = J. Antibiot | year = 1989 | volume = 42 | pages = 1475–1481 | author1 = Iida, T | author2 = Kobayashi, E | author3 = Yoshida, M | author4 = Sano, H | pmid = 2478515 | title = Calphostins, novel and specific inhibitors of protein kinase C. II. Chemical structures | issue = 10}}</ref> Calphostin C is a potent ] of ] (PKC). |
|
|
|
|
| ⚫ |
==References== |
|
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
== External links == |
| ⚫ |
] |
|
|
|
{{Commons-inline|Calphostins}} |
| ⚫ |
] |
|
|
|
|
|
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
⚫ |
] |
|
|
] |
|
|
|
|
|
{{polyphenol-stub}} |
|
{{Aromatic-stub}} |