| Revision as of 16:47, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,045 edits Saving copy of the {{chembox}} taken from revid 466097862 of page Zoalene for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 19:10, 30 January 2024 edit Michael7604 (talk | contribs)Extended confirmed users8,895 edits Category:Nitrotoluene derivatives |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 419272032 |
|
| verifiedrevid = 470638079 |
|
|ImageFile=Zoalene.png |
|
| ImageFile=Zoalene.png |
|
|ImageSize=150px |
|
| ImageSize=150px |
|
|IUPACName=2-Methyl-3,5-dinitrobenzamide |
|
| PIN = 2-Methyl-3,5-dinitrobenzamide |
|
|OtherNames=3,5-Dinitro-o-toluamide<br>Dinitolmide |
|
| OtherNames = 3,5-Dinitro-''o''-toluamide<br />Zoalene |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2982 |
|
| ChemSpiderID = 2982 |
|
| InChI = 1/C8H7N3O5/c1-4-6(8(9)12)2-5(10(13)14)3-7(4)11(15)16/h2-3H,1H3,(H2,9,12) |
|
| InChI = 1/C8H7N3O5/c1-4-6(8(9)12)2-5(10(13)14)3-7(4)11(15)16/h2-3H,1H3,(H2,9,12) |
| Line 17: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZEFNOZRLAWVAQF-UHFFFAOYSA-N |
|
| StdInChIKey = ZEFNOZRLAWVAQF-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 148-01-6 --> |
|
| CASNo=148-01-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=3092 |
|
|
| ATCvet = yes |
|
| UNII = AOX68RY4TV |
|
⚫ |
| PubChem=3092 |
| ⚫ |
| ATCCode_prefix = P51 |
|
|
⚫ |
| SMILES = O=()c1cc(cc(C(=O)N)c1C)()=O |
| ⚫ |
| ATCCode_suffix = AX12 |
|
| ⚫ |
| SMILES = O=()c1cc(cc(C(=O)N)c1C)()=O |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>8</sub>H<sub>7</sub>N<sub>3</sub>O<sub>5</sub> |
|
| Formula=C<sub>8</sub>H<sub>7</sub>N<sub>3</sub>O<sub>5</sub> |
|
| MolarMass=225.16 g/mol |
|
| MolarMass=225.16 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
|
| MeltingPtF=351 |
|
| MeltingPt= |
|
|
|
| MeltingPt_ref =<ref name=PGCH/> |
|
| BoilingPt= |
|
|
| Solubility= |
|
| BoilingPt= |
|
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
|
| ATCvet = yes |
| ⚫ |
| MainHazards= |
|
|
⚫ |
| ATCCode_prefix = P51 |
|
| FlashPt= |
|
|
⚫ |
| ATCCode_suffix = AX12 |
|
| Autoignition= |
|
|
|
}} |
|
|
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
|
| FlashPt=noncombustible |
|
|
| FlashPt_ref = <ref name=PGCH/> |
|
|
| AutoignitionPt = |
|
|
| PEL = none<ref name=PGCH>{{PGCH|0230}}</ref> |
|
|
| REL = TWA 5 mg/m<sup>3</sup><ref name=PGCH/> |
|
|
| IDLH = N.D.<ref name=PGCH/> |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Dinitolmide''' (or '''zoalene''') is a ] additive for ], used to prevent ] infections.<ref name="Gerhold">{{Cite journal |
|
|
| doi = 10.1637/9572-101310-Reg.1 |
|
|
| last1 = Gerhold | first1 = R. W. |
|
|
| last2 = Fuller | first2 = A. L. |
|
|
| last3 = Lollis | first3 = L. |
|
|
| last4 = Parr | first4 = C. |
|
|
| last5 = McDougald | first5 = L. R. |
|
|
| title = The Efficacy of Anticoccidial Products against ''Eimeria'' spp. in Northern Bobwhites |
|
|
| journal = Avian Diseases |
|
|
| volume = 55 |
|
|
| issue = 1 |
|
|
| pages = 59–64 |
|
|
| year = 2011 |
|
|
| pmid = 21500637 |
|
|
| s2cid = 30943649 }}</ref> It is sold under trade names such as '''Coccidine A''', '''Coccidot''', and '''Zoamix'''. |
|
|
|
|
|
Dinitolmide is usually added to feed in doses of 125 ppm (preventive) or 250 ppm (curative). It is a broad-spectrum anticoccidial drug,<ref name="Gerhold" /> preventing seven main strains of '']''. It leaves no residues in tissues.{{fact|date=December 2013}} It can be also used to prevent coccidiosis of domestic ]s. |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
* |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antiinfective-drug-stub}} |