| Revision as of 15:35, 19 May 2011 editCitation bot (talk | contribs)Bots5,449,851 editsm +: volume, issue, pages. Formatted dashes.← Previous edit |
Latest revision as of 21:03, 4 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Fluoroarenes; added Category:4-Fluorophenyl compounds using HotCat |
| (35 intermediate revisions by 29 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 412695530 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Flusilazole.png |
|
|
⚫ |
| verifiedrevid = 429896637 |
| ⚫ |
|ImageSize=200px |
|
|
|
| ImageFile = Flusilazol1.svg |
| ⚫ |
|IUPACName=1-((bis(4-fluorophenyl)methylsilyl)methyl)-1H-1,2,4-triazole |
|
|
⚫ |
| ImageFile2 = Flusilazole-3D-balls.png |
| ⚫ |
|OtherNames= DPX-H6573; |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| PIN = 1-{methyl}-1''H''-1,2,4-triazole |
|
⚫ |
| OtherNames = DPX-H6573; |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 85509-19-9 |
|
| CASNo = 85509-19-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = F3WG2VVD87 |
|
| PubChem = 73675 |
|
| PubChem = 73675 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 81922 |
|
| SMILES = c2ncnn2C(C)(c(cc1)ccc1F)c3ccc(F)cc3 |
|
| SMILES = c2ncnn2C(C)(c(cc1)ccc1F)c3ccc(F)cc3 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID = 66326 |
| ⚫ |
|Section2= {{Chembox Properties |
|
|
|
| InChI = 1/C16H15F2N3Si/c1-22(12-21-11-19-10-20-21,15-6-2-13(17)3-7-15)16-8-4-14(18)5-9-16/h2-11H,12H2,1H3 |
|
|
| InChIKey = FQKUGOMFVDPBIZ-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H15F2N3Si/c1-22(12-21-11-19-10-20-21,15-6-2-13(17)3-7-15)16-8-4-14(18)5-9-16/h2-11H,12H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FQKUGOMFVDPBIZ-UHFFFAOYSA-N |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
| Formula=C<sub>16</sub>H<sub>15</sub>F<sub>2</sub>N<sub>3</sub>Si |
|
| Formula=C<sub>16</sub>H<sub>15</sub>F<sub>2</sub>N<sub>3</sub>Si |
|
| Appearance= |
|
| Appearance= |
|
| Density= 315.392 g/cm<sup>3</sup> |
|
| Density = 1.31 g/cm<sup>3</sup> |
|
|
| MeltingPt = 53–55 °C[ |
| ⚫ |
| Solubility= |
|
|
|
| MolarMass= 315.392 g/mol |
|
⚫ |
| Solubility=41.9 mg/L (20°C) |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| FlashPt= |
|
| FlashPt= |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Flusilazole''' ('''DPX-H6573''') is an ] ] invented by ], which is used to control fungal infections on a variety of fruit and vegetable crops.<ref>{{Cite doi|10.1021/bk-1987-0355.ch026}}</ref><ref name="pmid11721516">{{cite journal |author=Bostanian NJ, Larocque N, Chouinard G, Coderre D |title=Baseline toxicity of several pesticides to Hyaliodes vitripennis (Say) (Hemiptera: Miridae) |journal=Pest Management Science |volume=57 |issue=11 |pages=1007–10 |year=2001 |month=November |pmid=11721516 |doi=10.1002/ps.374 |url=}}</ref><ref name="pmid20013877">{{cite journal |author=Eckert MR, Rossall S, Selley A, Fitt BD |title=Effects of fungicides on in vitro spore germination and mycelial growth of the phytopathogens Leptosphaeria maculans and L. biglobosa (phoma stem canker of oilseed rape) |journal=Pest Management Science |volume=66 |issue=4 |pages=396–405 |year=2010 |month=April |pmid=20013877 |doi=10.1002/ps.1890 |url=}}</ref> It is moderately toxic to animals and has been shown to produce birth defects and embryotoxicity at high doses.<ref name="pmid17187383">{{cite journal |author=Farag AT, Ibrahim HH |title=Developmental toxic effects of antifungal flusilazole administered by gavage to mice |journal=Birth Defects Research. Part B, Developmental and Reproductive Toxicology |volume=80 |issue=1 |pages=12–7 |year=2007 |month=February |pmid=17187383 |doi=10.1002/bdrb.20098 |url=}}</ref><ref name="pmid21238576">{{cite journal |author=Hermsen SA, van den Brandhof EJ, van der Ven LT, Piersma AH |title=Relative embryotoxicity of two classes of chemicals in a modified zebrafish embryotoxicity test and comparison with their in vivo potencies |journal=Toxicology in Vitro : an International Journal Published in Association with BIBRA |volume= 25|issue= 3|pages= 745–753|year=2011 |month=January |pmid=21238576 |doi=10.1016/j.tiv.2011.01.005 |url=}}</ref> |
|
'''Flusilazole''' ('''DPX-H6573''') is an ] ] invented by ], which is used to control fungal infections on a variety of fruit and vegetable crops.<ref>{{Cite book | last1 = Moberg | first1 = W. K. | last2 = Basarab | first2 = G. S. | last3 = Cuomo | first3 = J. | last4 = Liang | first4 = P. H. | title = Synthesis and Chemistry of Agrochemicals | chapter = Biologically Active Organosilicon Compounds | series = ACS Symposium Series | doi = 10.1021/bk-1987-0355.ch026 | volume = 355 | pages = 288–301 | year = 1987 | isbn = 9780841214347 }}</ref><ref name="pmid11721516">{{cite journal |vauthors=Bostanian NJ, Larocque N, Chouinard G, Coderre D |title=Baseline toxicity of several pesticides to Hyaliodes vitripennis (Say) (Hemiptera: Miridae) |journal=Pest Management Science |volume=57 |issue=11 |pages=1007–10 |date=November 2001 |pmid=11721516 |doi=10.1002/ps.374 }}</ref><ref name="pmid20013877">{{cite journal |vauthors=Eckert MR, Rossall S, Selley A, Fitt BD |title=Effects of fungicides on in vitro spore germination and mycelial growth of the phytopathogens Leptosphaeria maculans and L. biglobosa (phoma stem canker of oilseed rape) |journal=Pest Management Science |volume=66 |issue=4 |pages=396–405 |date=April 2010 |pmid=20013877 |doi=10.1002/ps.1890 |doi-access=free }}</ref> It is moderately toxic to ]s and has been shown to produce birth defects in high doses.<ref name="pmid17187383">{{cite journal |vauthors=Farag AT, Ibrahim HH |title=Developmental toxic effects of antifungal flusilazole administered by gavage to mice |journal=Birth Defects Research Part B: Developmental and Reproductive Toxicology |volume=80 |issue=1 |pages=12–7 |date=February 2007 |pmid=17187383 |doi=10.1002/bdrb.20098 }}</ref><ref name="pmid21238576">{{cite journal |vauthors=Hermsen SA, van den Brandhof EJ, van der Ven LT, Piersma AH |title=Relative embryotoxicity of two classes of chemicals in a modified zebrafish embryotoxicity test and comparison with their in vivo potencies |journal=] |volume= 25|issue= 3|pages= 745–753|date=January 2011 |pmid=21238576 |doi=10.1016/j.tiv.2011.01.005 |doi-access=free }}</ref> |
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
== Reference == |
|
==External links== |
|
|
* {{PPDB|350}} |
|
<references/> |
|
|
|
|
| ⚫ |
{{organic-compound-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
⚫ |
{{organic-compound-stub}} |