| Revision as of 06:56, 27 December 2010 editYobot (talk | contribs)Bots4,733,870 editsm WP:CHECKWIKI error fixes + general fixes, References after punctuation per WP:REFPUNC and WP:PAIC, added wikify tag using AWB (7510)← Previous edit |
Latest revision as of 16:17, 2 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (12 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{Wikify|date=December 2010}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| verifiedrevid = 404420136 |
|
| Name = Guibourtinidol |
|
| Name = Guibourtinidol |
|
| ImageFile = Guibourtinidol.svg |
|
| ImageFile = Guibourtinidol.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Chemical structure of guibourtinidol |
|
| ImageName = Chemical structure of guibourtinidol |
|
| IUPACName = 2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol |
|
| IUPACName = (2''R'',3''S'')-Flavan-3,4′,7-triol |
|
|
| SystematicName = (2''R'',3''S'')-2-(4-Hydroxyphenyl)-3,4-dihydro-2''H''-1-benzopyran-2,7-diol |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = |
|
| CASNo_Ref = |
|
| CASNo_Ref = |
|
| CASOther = |
|
| CASNoOther = |
|
| PubChem = |
|
| PubChem = 9878329 |
|
|
| ChemSpiderID = 8054006 |
|
| SMILES = Oc1ccc(cc1)C2Oc3cc(O)ccc3CC2O |
|
| SMILES = Oc1ccc(cc1)3Oc2cc(O)ccc2C3O |
|
| InChI = |
|
|
|
| InChI = 1/C15H14O4/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15/h1-6,8,13,15-18H,7H2/t13-,15+/m0/s1 |
|
|
| InChIKey = RHYGXRGFSFQNLC-DZGCQCFKBZ |
|
|
| StdInChI = 1S/C15H14O4/c16-11-4-1-9(2-5-11)15-13(18)7-10-3-6-12(17)8-14(10)19-15/h1-6,8,13,15-18H,7H2/t13-,15+/m0/s1 |
|
|
| StdInChIKey = RHYGXRGFSFQNLC-DZGCQCFKSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>14</sub>O<sub>4</sub> |
|
| Formula = C<sub>15</sub>H<sub>14</sub>O<sub>4</sub> |
|
| MolarMass = 258.27 g/mol |
|
| MolarMass = 258.27 g/mol |
|
| ExactMass = 258.089209 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Guibourtinidol''' is a ]. It can be foud in the heartwood of '']''.<ref></ref> |
|
'''Guibourtinidol''' is a ]. It can be found in the heartwood of '']''.<ref>{{Dead link|date=March 2022 |bot=InternetArchiveBot |fix-attempted=yes }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 37: |
Line 40: |
|
] |
|
] |
|
|
|
|
|
⚫ |
{{aromatic-stub}} |
|
|
|
| ⚫ |
{{polyphenol-stub}} |
|