Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Hydramethylnon: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 14:41, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,045 edits Saving copy of the {{chembox}} taken from revid 443861708 of page Hydramethylnon for the Chem/Drugbox validation project (updated: 'ChEMBL').  Latest revision as of 21:14, 15 December 2024 edit Bosula (talk | contribs)Extended confirmed users601 edits add linkTag: Visual edit 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 443859726 | verifiedrevid = 461771725
| Name = Hydramethylnon | Name = Hydramethylnon
| ImageFile = Hydramethylnon.png | ImageFile = Hydramethylnon.svg
| IUPACName = 2(1''H'')-pyrimidinone, tetrahydro-5,5-dimethyl-, | IUPACName=2(1H-4,4-dimethyl tetrahydro pyrimidinylidene )
(3-(4-(trifluoromethyl)phenyl) (3-(4-(trifluoromethyl)phenyl)
-1-(2-(4-(trifluoromethyl)phenyl)ethenyl) -1-(2-(4-(trifluoromethyl)phenyl)ethenyl)
-2-propenylidene)hydrazone -2-propenylidene)hydrazone
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445168 | ChemSpiderID = 4445168
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 464812 | ChEMBL = 464812
| PubChem = 5281875 | PubChem = 5281875
Line 21: Line 21:
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 67485-29-4 | CASNo = 67485-29-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = J265GZ7MFJ
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C10994 | KEGG = C10994
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 38531 | ChEBI = 38531
| SMILES = FC(F)(F)c1ccc(cc1)\C=C\C(=N/N/C2=N/CC(C)(C)CN2)/C=C/c3ccc(cc3)C(F)(F)F | SMILES = FC(F)(F)c1ccc(cc1)C=CC(=NNC2=NCC(C)(C)CN2)C=Cc3ccc(cc3)C(F)(F)F
| InChI = 1/C25H24F6N4/c1-23(2)15-32-22(33-16-23)35-34-21(13-7-17-3-9-19(10-4-17)24(26,27)28)14-8-18-5-11-20(12-6-18)25(29,30)31/h3-14H,15-16H2,1-2H3,(H2,32,33,35)/b13-7+,14-8+ | InChI = 1/C25H24F6N4/c1-23(2)15-32-22(33-16-23)35-34-21(13-7-17-3-9-19(10-4-17)24(26,27)28)14-8-18-5-11-20(12-6-18)25(29,30)31/h3-14H,15-16H2,1-2H3,(H2,32,33,35)/b13-7+,14-8+
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=25
| Formula = C<sub>25</sub>H<sub>24</sub>F<sub>6</sub>N<sub>4</sub>
| H=24
| Appearance = yellow to orange crystalline solid
| F=6
| MolarMass = 494.50 g/mol
| Density = | N=4
| Appearance = Yellow to orange crystalline solid
| MeltingPt = 185-190 °C
| BoilingPt = | Density =
| MeltingPtC = 185 to 190
| MeltingPt_notes =
| BoilingPt =
}} }}
| Section7 = {{Chembox Hazards |Section7={{Chembox Hazards
| NFPA-H = 1 | NFPA-H = 1
| NFPA-F = 1 | NFPA-F = 1
| NFPA-R = 0 | NFPA-R = 0
}} }}
}} }}
'''Hydramethylnon''' (AC 217,300) is an ] used primarily in the form of ] for ]es and ]s.<ref name=":02">{{Cite book |last=Jeschke |first=Peter |url=https://onlinelibrary.wiley.com/doi/book/10.1002/9783527699261 |title=Modern Crop Protection Compounds |last2=Witschel |first2=Matthias |last3=Krämer |first3=Wolfgang |last4=Schirmer |first4=Ulrich |date=25 January 2019 |publisher=Wiley‐VCH |year=2019 |isbn=9783527699261 |edition=3rd |pages=1156-1201 |chapter=32.3 Inhibitors of Mitochondrial Electron Transport: Acaricides and Insecticides}}</ref><ref name="vspn"></ref><ref>{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/compound/hydramethylnon#section=Pharmacology-and-Biochemistry | title = Hydramethylnon | publisher = ]}}</ref> It works by inhibiting ] in the mitochondrial inner membrane and leads to a halting of ] (] class 20A). Some brands of hydramethylnon are ], Blatex, Combat, Cyaforce, Cyclon, Faslane, Grant's, Impact, Matox, Maxforce, Pyramdron, Siege, Scuttle and Wipeout. Hydramethylnon is a slow-acting poison with delayed toxicity that needs to be eaten to be effective.<ref name=npic/>

==Toxicology==
Hydramethylnon has low toxicity in mammals.<ref name=vspn/><ref name=npic>{{cite web | url = http://npic.orst.edu/factsheets/hydragen.pdf | title = Hydramethylnon | publisher = National Pesticide Information Center}}</ref> The oral {{LD50}} is 1100–1300&nbsp;mg/kg in rats and above 28,000&nbsp;mg/kg in dogs.<ref name=npic/> Hydramethylnon is ]; the 96-hour LC<sub>50</sub> in rainbow trout is 0.16&nbsp;mg/L, 0.10&nbsp;mg/L in ], and 1.70&nbsp;mg/L in ].

Hydramethylnon, when fed to rats for two years, led to an increase in ] and ]s at the highest dose; therefore, the ] classifies hydramethylnon as a possible human carcinogen.<ref name=npic/>

==See also==
* ], another insecticide used for similar purposes

==References==
{{Reflist}}

==External links==
* {{PPDB|386}}
*
*
*
* ].
* ]

{{Insecticides}}

]
]
]
]
]
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Hydramethylnon: Difference between pages Add topic