| Revision as of 05:20, 1 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Ph← Previous edit |
Latest revision as of 20:27, 16 July 2024 edit undoحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits removed Category:Indandiones; added Category:1,3-Indandiones using HotCat |
| (12 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Verifiedfields = changed |
|
|
⚫ |
| verifiedrevid = 437180804 |
| ⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| IUPAC_name = 5-Bromo-2-phenyl-1''H''-indene-1,3(2''H'')-dione |
|
⚫ |
| image = Isobromindione.png |
|
|
| alt = Structural formula of isobromindione |
|
|
| image2 = Isobromindione 3D ball.png |
|
|
| alt2 = Ball-and-stick model of the isobromindione molecule |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 1470-35-5 |
|
⚫ |
| ATC_prefix = M04 |
|
⚫ |
| ATC_suffix = AB04 |
|
⚫ |
| PubChem = 68953 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = J1J87P409K |
|
| UNII = J1J87P409K |
| ⚫ |
| verifiedrevid = 407441286 |
|
| ⚫ |
| IUPAC_name = 5-Bromo-2-phenyl-1''H''-indene-1,3(2''H'')-dione |
|
| ⚫ |
| image = Isobromindione.png |
|
| ⚫ |
| CAS_number = |
|
| ⚫ |
| ATC_prefix = M04 |
|
| ⚫ |
| ATC_suffix = AB04 |
|
| ⚫ |
| PubChem = 68953 |
|
| ⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07279 |
|
| KEGG = D07279 |
|
|
| ChemSpiderID = 62176 |
|
| C=15|H=9|Br=1|O=2 |
|
|
|
|
|
| molecular_weight = 301.13 g/mol |
|
|
|
<!--Chemical data--> |
| ⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
| C=15 | H=9 | Br=1 | O=2 |
|
|
| StdInChI = 1S/C15H9BrO2/c16-10-6-7-11-12(8-10)15(18)13(14(11)17)9-4-2-1-3-5-9/h1-8,13H |
| ⚫ |
| metabolism = |
|
|
|
| StdInChIKey = QFLZIWVSQDZLNW-UHFFFAOYSA-N |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| smiles = c1ccc(cc1)C2C(=O)c3ccc(cc3C2=O)Br |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Isobromindione''' is a drug used in the treatment of ].<ref>{{Cite web | url = https://www.genome.jp/dbget-bin/www_bget?D07279 | title = Isobromindione | publisher = | work = ] DRUG Database }}</ref><ref>{{cite book | vauthors = Dorian AF |title=Elsevier's Encyclopaedic Dictionary of Medicine |date=1987 |publisher=Elsevier |location=Amsterdam |isbn=978-0-444-42826-4}}</ref> |
|
'''Isobromindione''' is a drug used in the treatment of ]. |
|
|
|
|
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Antigout preparations}} |
|
{{Antigout preparations}} |
|
|
|
|
|
|
|
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|