| Revision as of 00:34, 13 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 00:28, 17 November 2023 edit undoReba16 (talk | contribs)Extended confirmed users8,067 edits ref |
| (29 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
|
{{DISPLAYTITLE:Leukotriene D<sub>4</sub>}} |
|
{{chembox |
|
{{chembox |
|
|
| Name = Leukotriene D<sub>4</sub> |
| ⚫ |
| verifiedrevid = 396932636 |
|
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Leukotriene D4.svg |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize= |
|
|
⚫ |
| verifiedrevid = 428848536 |
|
|IUPACName= |
|
|
⚫ |
| ImageFile=Leukotriene D4.svg |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| ImageSize= |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| SystematicName=(5''S'',6''R'',7''E'',9''E'',11''Z'',14''Z'')-6-({(2''R'')-2-Amino-3--3-oxopropyl}sulfanyl)-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| ⚫ |
| CASNo=73836-78-9 |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| PubChem=5280878 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| SMILES= |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| MeSHName=Leukotriene+D4 |
|
|
⚫ |
| CASNo=73836-78-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5FNY4416UE |
|
⚫ |
| PubChem=5280878 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 28666 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 288943 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444401 |
|
|
| SMILES= CCCCC\C=C/C\C=C/C=C/C=C/(SC(N)C(=O)NCC(=O)O)(O)CCCC(=O)O |
|
|
| InChI = 1/C25H40N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h6-7,9-13,16,20-22,28H,2-5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b7-6-,10-9-,12-11+,16-13+/t20-,21-,22+/m0/s1 |
|
|
| InChIKey = YEESKJGWJFYOOK-IJHYULJSBX |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C25H40N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h6-7,9-13,16,20-22,28H,2-5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b7-6-,10-9-,12-11+,16-13+/t20-,21-,22+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YEESKJGWJFYOOK-IJHYULJSSA-N |
|
⚫ |
| MeSHName=Leukotriene+D4 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C = 25 | H = 40 | N = 2 | O = 6 | S = 1 |
|
| Formula=C<sub>25</sub>H<sub>40</sub>N<sub>2</sub>O<sub>6</sub>S |
|
|
|
| Appearance= |
|
| MolarMass=496.661 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Leukotriene D4''' is a ]. |
|
|
|
'''Leukotriene D<sub>4</sub>''' ('''LTD<sub>4</sub>''') is one of the ]. Its main function in the body is to induce the ], resulting in ] and ]. It also increases ]. LTD<sub>4</sub> is released by ]s. Other leukotrienes that function in a similar manner are leukotrienes ] and ]. Pharmacological agents that inhibit the function of these leukotrienes are ] (e.g., ], ]) and are useful for ].<ref>{{cite web | url = https://www.drugs.com/monograph/montelukast.html | title = Montelukast (Monograph) | publisher = drugs.com }}</ref> |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Leukotrienes}} |
|
{{Leukotrienes}} |
|
|
{{Leukotrienergics}} |
|
|
|
|
|
|
|
|
|
|
|
] |
|
] |
| Line 38: |
Line 59: |
|
|
|
|
|
{{biochemistry-stub}} |
|
{{biochemistry-stub}} |
|
|
|
|
] |
|