Revision as of 17:10, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 17:01, 1 October 2021 edit undo3PPYB6 (talk | contribs)Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers8,661 edits Added a grammar correction to the article.Tag: Visual edit |
(26 intermediate revisions by 17 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 426771635 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 449562812 |
|
| Name = Licochalcone A |
|
| Name = Licochalcone A |
|
| ImageFile = Licochalcone a.svg |
|
| ImageFile = Licochalcone_A2DCSD.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of licochalcone A |
|
| ImageName = Chemical structure of licochalcone A |
|
| ImageAlt = Chemical structure of licochalcone A |
|
| ImageAlt = Chemical structure of licochalcone A |
|
| IUPACName = (E)-3--1-(4-hydroxyphenyl)prop-2-en-1-one |
|
| PIN = (2''E'')-3--1-(4-hydroxyphenyl)prop-2-en-1-one |
|
| OtherNames = Licochalcone a |
|
| OtherNames = Licochalcone a |
|
|
| SystematicName = |
|
|Section1= {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 58749-22-7 |
|
| CASNo = 58749-22-7 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
| CASOther = |
|
|
| PubChem = 5318998 |
|
| PubChem = 5318998 |
|
|
| UNII = JTV5467968 |
⚫ |
| SMILES = CC(C)(C=C)C1=C(C=C(C(=C1)C=CC(=O)C2=CC=C(C=C2)O)OC)O |
|
|
| InChI = |
|
| ChEMBL = 139702 |
|
|
| ChEBI = 125689 |
|
|
| EINECS = 635-678-2 |
|
|
| DTXSID = DTXSID10904181 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4477422 |
|
⚫ |
| SMILES = CC(C)(C=C)c1cc(c(cc1O)OC)/C=C/C(=O)c2ccc(cc2)O |
|
|
| InChI = 1/C21H22O4/c1-5-21(2,3)17-12-15(20(25-4)13-19(17)24)8-11-18(23)14-6-9-16(22)10-7-14/h5-13,22,24H,1H2,2-4H3/b11-8+ |
|
|
| InChIKey = KAZSKMJFUPEHHW-DHZHZOJOBU |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C21H22O4/c1-5-21(2,3)17-12-15(20(25-4)13-19(17)24)8-11-18(23)14-6-9-16(22)10-7-14/h5-13,22,24H,1H2,2-4H3/b11-8+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = KAZSKMJFUPEHHW-DHZHZOJOSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=21|H=22|O=4 |
|
| Formula = C<sub>21</sub>H<sub>22</sub>O<sub>4</sub> |
|
|
| MolarMass = 338.39 g/mol |
|
|
| ExactMass = 338.151809 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
|
| ExternalSDS = |
|
| RPhrases = {{R20}}, {{R21}}, {{R22}} |
|
|
|
| GHSPictograms = {{GHS07}}<ref name="SDS">{{cite web| title=Licochalcone A Safety Data Sheet | website=Cayman Chemicals| url=https://www.caymanchem.com/msdss/11853m.pdf}}</ref> |
|
| SPhrases = {{S36}} |
|
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302|312|332}}<ref name="SDS"/> |
|
|
| PPhrases = {{P-phrases|261|264|280}}<ref name="SDS"/> |
|
}} |
|
}} |
|
|
| Section4 = |
|
|
| Section5 = |
|
|
| Section6 = |
|
}} |
|
}} |
|
'''Licochalcone A''' is a ], a type of natural phenols. It can be isolated from root of '']''<ref>Licochalcone-A, a novel flavonoid isolated from licorice root (Glycyrrhiza glabra), causes G2 and late-G1 arrests in androgen-independent PC-3 prostate cancer cells. Yue Fu, Tze-chen Hsieh, Junqiao Guo, Jan Kunicki, Marietta Y.W.T. Lee, Zbigniew Darzynkiewicz and Joseph M. Wu, Biochemical and Biophysical Research Communications, Volume 322, Issue 1, 10 September 2004, pp. 263-270, {{doi|10.1016/j.bbrc.2004.07.094}}</ref> or '']''.<ref>In Vitro Antimycobacterial and Antilegionella Activity of Licochalcone A from Chinese Licorice Roots. Alice Friis-Møller, Ming Chen, Kurt Fuursted, Søren Brøgger Christensen and Arsalan Kharazmi, Planta Med 2002, 68(5), pp. 416-419, {{doi|10.1055/s-2002-32087}}</ref> It shows ] properties in vitro.<ref>Licochalcone A, a new antimalarial agent, inhibits in vitro growth of the human malaria parasite Plasmodium falciparum and protects mice from P. yoelii infection. M Chen, T G Theander, S B Christensen, L Hviid, L Zhai and A Kharazmi, Antimicrob Agents Chemother, 1994 July, 38(7), pp. 1470–1475, {{PMCID|PMC284578}}</ref> |
|
|
|
|
|
|
|
'''Licochalcone A''' is a ], a type of natural ]. It can be isolated from the root of '']''<ref name = can>{{Cite journal | last1 = Fu | first1 = Y. | last2 = Hsieh | first2 = T. C. | last3 = Guo | first3 = J. | last4 = Kunicki | first4 = J. | last5 = Lee | first5 = M. Y. W. T. | last6 = Darzynkiewicz | first6 = Z. | last7 = Wu | first7 = J. M. | doi = 10.1016/j.bbrc.2004.07.094 | title = Licochalcone-A, a novel flavonoid isolated from licorice root (Glycyrrhiza glabra), causes G2 and late-G1 arrests in androgen-independent PC-3 prostate cancer cells | journal = Biochemical and Biophysical Research Communications | volume = 322 | issue = 1 | pages = 263–270 | year = 2004 | pmid = 15313200}}</ref> (liquorice) or '']''.<ref name = bac>{{Cite journal | last1 = Friis-Møller | first1 = A. | last2 = Chen | first2 = M. | last3 = Fuursted | first3 = K. | last4 = Christensen | first4 = S. R. B. G. | last5 = Kharazmi | first5 = A. | title = In Vitro Antimycobacterial and Antilegionella Activity of Licochalcone a from Chinese Licorice Roots | doi = 10.1055/s-2002-32087 | journal = Planta Medica | volume = 68 | issue = 5 | pages = 416–419 | year = 2002 | pmid = 12058317}}</ref> It shows ], ], ] and ] (specifically against influenza ]) properties ''in vitro''.<ref name = can/><ref name = bac/><ref>{{Cite journal |
|
<!-- ==Metabolism== --> |
|
|
|
| last1 = Chen | first1 = M. |
|
|
| last2 = Theander | first2 = T. G. |
|
|
| last3 = Christensen | first3 = S. B. |
|
|
| last4 = Hviid | first4 = L. |
|
|
| last5 = Zhai | first5 = L. |
|
|
| last6 = Kharazmi | first6 = A. |
|
|
| title = Licochalcone A, a new antimalarial agent, inhibits in vitro growth of the human malaria parasite Plasmodium falciparum and protects mice from P. Yoelii infection |
|
|
| journal = Antimicrobial Agents and Chemotherapy |
|
|
| volume = 38 |
|
|
| issue = 7 |
|
|
| pages = 1470–1475 |
|
|
| year = 1994 |
|
|
| pmid = 7979274 |
|
|
| pmc = 284578 | doi=10.1128/aac.38.7.1470 |
|
|
}}</ref><ref>{{cite journal|last=Dao|first=TT|author2=Nguyen, PH |author3=Lee, HS |author4=Kim, E |author5=Park, J |author6=Lim, SI |author7= Oh, WK |title=Chalcones as novel influenza A (H1N1) neuraminidase inhibitors from Glycyrrhiza inflata.|journal=Bioorganic & Medicinal Chemistry Letters|date=January 2011|volume=21|issue=1|pages=294–8|doi=10.1016/j.bmcl.2010.11.016|pmid=21123068}}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist|2}} |
|
|
|
|
|
{{chalconoid}} |
|
{{chalconoid}} |
Line 47: |
Line 80: |
|
|
|
|
|
|
|
|
|
{{natural-phenol-stub}} |
|
{{phenol-stub}} |
|
|
|
|
] |
|