Revision as of 13:49, 24 December 2024 editCitation bot (talk | contribs)Bots5,450,521 edits Altered pages. Add: pmid, pages, issue, volume, journal, date, title, authors 1-1. Formatted dashes. | Use this bot. Report bugs. | Suggested by Innerstream | #UCB_webform← Previous edit |
Latest revision as of 07:56, 26 December 2024 edit undoCitation bot (talk | contribs)Bots5,450,521 edits Added pmid. | Use this bot. Report bugs. | Suggested by Graeme Bartlett | #UCB_toolbar |
(3 intermediate revisions by 2 users not shown) |
Line 50: |
Line 50: |
|
| CAS_number = 54496-44-5 |
|
| CAS_number = 54496-44-5 |
|
| PubChem = 166572 |
|
| PubChem = 166572 |
|
|
| ChemSpiderID = 145767 |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChEMBL = 2110807 |
|
<!-- Chemical and physical data --> |
|
<!-- Chemical and physical data --> |
|
| IUPAC_name = 2-Methyl-''N''-thiazol-6-yl)phenyl]propanamide |
|
| IUPAC_name = 2-Methyl-''N''-thiazol-6-yl)phenyl]propanamide |
|
| smiles = CC(C)C(=O)NC1=CC=CC(=C1)C2CN3CCSC3=N2 |
|
| smiles = CC(C)C(=O)NC1=CC=CC(=C1)C2CN3CCSC3=N2 |
|
|
| StdInChI=1S/C15H19N3OS/c1-10(2)14(19)16-12-5-3-4-11(8-12)13-9-18-6-7-20-15(18)17-13/h3-5,8,10,13H,6-7,9H2,1-2H3,(H,16,19) |
|
|
| StdInChIKey = YWDWYOALXURQPZ-UHFFFAOYSA-N |
|
| C = 15 | H = 19 | N = 3 | O = 1 | S = 1 |
|
| C = 15 | H = 19 | N = 3 | O = 1 | S = 1 |
|
}} |
|
}} |
|
|
|
|
|
'''Butamisole''' is a pharmaceutical drug used in veterinary medicine.<ref>{{cite journal | title = The efficacy and safety of injectable butamisole in dogs | journal = Veterinary Medicine & Small Animal Clinician | date = 1979 | volume = 74 | issue = 4 | pages = 487–495 | |
|
'''Butamisole''' is a pharmaceutical drug used in veterinary medicine.<ref>{{cite journal | title = The efficacy and safety of injectable butamisole in dogs | journal = Veterinary Medicine & Small Animal Clinician | date = 1979 | volume = 74 | issue = 4 | pages = 487–495 | |
|
author = B. T. Alford, G. T. Wang, T. R. Garces, R. B. Dougherty, R. E. Bradley }}</ref> It is an ] of the ] class.<ref>{{Cite journal | doi = 10.1016/S1090-0233(05)80005-X | title = Modes of action of anthelmintic drugs | date = 1997 | last1 = Martin | first1 = R.J. | journal = The Veterinary Journal | volume = 154 | issue = 1 | pages = 11–34 | pmid = 9265850 }}</ref> In dogs it is used for the treatment of infections with ]s such as '']'' and with ] such as '']''.<ref name=ncats>{{cite web | url = https://drugs.ncats.io/substance/XVB7982801 | title = Butamisole | publisher = ] | work = Inxight Drugs }}</ref> It acts as a ] ] that causes sustained muscle contraction in the parasite followed by depolarizing neuromuscular blockade which leads to paralysis.<ref name=ncats/> |
|
author = B. T. Alford, G. T. Wang, T. R. Garces, R. B. Dougherty, R. E. Bradley | pmid = 256371 }}</ref> It is an ] of the ] class.<ref>{{Cite journal | doi = 10.1016/S1090-0233(05)80005-X | title = Modes of action of anthelmintic drugs | date = 1997 | last1 = Martin | first1 = R.J. | journal = The Veterinary Journal | volume = 154 | issue = 1 | pages = 11–34 | pmid = 9265850 }}</ref> In dogs it is used for the treatment of infections with ]s such as '']'' and with ] such as '']''.<ref name=ncats>{{cite web | url = https://drugs.ncats.io/substance/XVB7982801 | title = Butamisole | publisher = ] | work = Inxight Drugs }}</ref> It acts as a ] ] that causes sustained muscle contraction in the parasite followed by depolarizing neuromuscular blockade which leads to paralysis.<ref name=ncats/> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Veterinary-med-stub}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |